CymitQuimica logo

CAS 1143461-40-8

:

1-(4-Bromo-4-penten-1-yl)-3-methylbenzene

Description:
1-(4-Bromo-4-penten-1-yl)-3-methylbenzene, also known by its CAS number 1143461-40-8, is an organic compound characterized by the presence of a brominated alkenyl group attached to a methyl-substituted aromatic ring. The structure features a 4-bromo-4-penten-1-yl group, which introduces a double bond and a bromine atom, contributing to its reactivity and potential applications in organic synthesis. The 3-methylbenzene moiety, or pseudocumene, provides a stable aromatic framework, enhancing the compound's stability and hydrophobic characteristics. This compound may exhibit properties typical of both alkenes and aromatic compounds, such as varying degrees of polarity and potential for electrophilic substitution reactions. Its unique structure suggests potential uses in materials science, pharmaceuticals, or as an intermediate in chemical synthesis. However, specific physical properties such as boiling point, melting point, and solubility would need to be determined experimentally or sourced from chemical databases for precise applications and handling guidelines.
Formula:C12H15Br
InChI:InChI=1S/C12H15Br/c1-10-5-3-7-12(9-10)8-4-6-11(2)13/h3,5,7,9H,2,4,6,8H2,1H3
InChI key:InChIKey=TWCJUCJXMRAQEN-UHFFFAOYSA-N
SMILES:C(CCC(Br)=C)C1=CC(C)=CC=C1
Synonyms:
  • 1-(4-Bromo-4-penten-1-yl)-3-methylbenzene
  • Benzene, 1-(4-bromo-4-penten-1-yl)-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.