CAS 1143461-41-9

1-Methyl-3-(4-methyl-4-penten-1-yl)benzene

Description:

1-Methyl-3-(4-methyl-4-penten-1-yl)benzene, also known by its CAS number 1143461-41-9, is an organic compound that belongs to the class of aromatic hydrocarbons. Its structure features a benzene ring substituted with a methyl group and a side chain containing a 4-methyl-4-penten-1-yl group, which contributes to its unique properties. This compound is characterized by its hydrophobic nature, making it insoluble in water but soluble in organic solvents. It typically exhibits a distinct aromatic odor, common to many benzene derivatives. The presence of the double bond in the side chain may impart reactivity, allowing for potential participation in various chemical reactions, such as polymerization or electrophilic substitution. Additionally, its molecular structure suggests potential applications in the synthesis of more complex organic molecules or as an intermediate in chemical manufacturing. Safety data should be consulted for handling, as with many aromatic compounds, it may pose health risks upon exposure.

Formula: C₁₃H₁₈

InChI: InChI=1S/C13H18/c1-11(2)6-4-8-13-9-5-7-12(3)10-13/h5,7,9-10H,1,4,6,8H2,2-3H3

InChI key: InChIKey=HFLBXBFNYRAEGC-UHFFFAOYSA-N

SMILES: C(CCC(C)=C)C1=CC(C)=CC=C1

Synonyms:

• Benzene, 1-methyl-3-(4-methyl-4-penten-1-yl)-
• 1-Methyl-3-(4-methyl-4-penten-1-yl)benzene