CAS 1143461-51-1
:1-Chloro-3-fluoro-5-(4-methyl-4-penten-1-yl)benzene
Description:
1-Chloro-3-fluoro-5-(4-methyl-4-penten-1-yl)benzene is an organic compound characterized by the presence of a benzene ring substituted with a chlorine atom, a fluorine atom, and a branched alkyl group. The chlorine and fluorine substituents are located at the 1 and 3 positions, respectively, while the 5-position is occupied by a 4-methyl-4-penten-1-yl group, which introduces a degree of unsaturation and contributes to the compound's reactivity. This compound is likely to exhibit hydrophobic characteristics due to the aromatic nature of the benzene ring and the presence of non-polar alkyl substituents. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of specialty chemicals or pharmaceuticals. Additionally, the presence of halogen atoms may impart unique properties such as increased stability or altered reactivity compared to non-halogenated analogs. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C12H14ClF
InChI:InChI=1S/C12H14ClF/c1-9(2)4-3-5-10-6-11(13)8-12(14)7-10/h6-8H,1,3-5H2,2H3
InChI key:InChIKey=ZNSVSGYDYYOPEU-UHFFFAOYSA-N
SMILES:C(CCC(C)=C)C1=CC(Cl)=CC(F)=C1
Synonyms:- Benzene, 1-chloro-3-fluoro-5-(4-methyl-4-penten-1-yl)-
- 1-Chloro-3-fluoro-5-(4-methyl-4-penten-1-yl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.