CymitQuimica logo

CAS 1143461-58-8

:

1-Fluoro-3-(4-methyl-4-penten-1-yl)benzene

Description:
1-Fluoro-3-(4-methyl-4-penten-1-yl)benzene is an organic compound characterized by the presence of a fluorine atom and a substituted benzene ring. The structure features a fluoro group attached to the third position of the benzene ring, while a 4-methyl-4-penten-1-yl group is attached at the para position. This compound is likely to exhibit properties typical of both aromatic compounds and alkenes, including potential reactivity due to the double bond in the alkenyl side chain. The presence of the fluorine atom may influence its polarity, making it more soluble in polar solvents compared to non-fluorinated analogs. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its unique structure could also impart specific physical properties, such as boiling and melting points, which would be influenced by the steric and electronic effects of the substituents. Overall, 1-Fluoro-3-(4-methyl-4-penten-1-yl)benzene represents a versatile compound in the realm of organic chemistry.
Formula:C12H15F
InChI:InChI=1S/C12H15F/c1-10(2)5-3-6-11-7-4-8-12(13)9-11/h4,7-9H,1,3,5-6H2,2H3
InChI key:InChIKey=HUAAOFATDKVGKB-UHFFFAOYSA-N
SMILES:C(CCC(C)=C)C1=CC(F)=CC=C1
Synonyms:
  • Benzene, 1-fluoro-3-(4-methyl-4-penten-1-yl)-
  • 1-Fluoro-3-(4-methyl-4-penten-1-yl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.