CymitQuimica logo

CAS 1143461-60-2

:

1-(4-Chloro-4-penten-1-yl)-4-fluorobenzene

Description:
1-(4-Chloro-4-penten-1-yl)-4-fluorobenzene, identified by its CAS number 1143461-60-2, is an organic compound characterized by the presence of both a fluorobenzene and a chloropentenyl group. This compound features a fluorine atom attached to a benzene ring, which enhances its reactivity and potential applications in various chemical reactions. The chloropentenyl moiety introduces a double bond, contributing to its unsaturation and making it a candidate for further functionalization. The presence of chlorine and fluorine atoms suggests that this compound may exhibit unique electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. Additionally, the structural features may impart specific physical properties, such as solubility and boiling point, which are essential for its application in synthesis or as an intermediate in the production of more complex molecules. Overall, this compound's unique combination of functional groups makes it of interest in fields such as medicinal chemistry, materials science, and organic synthesis.
Formula:C11H12ClF
InChI:InChI=1S/C11H12ClF/c1-9(12)3-2-4-10-5-7-11(13)8-6-10/h5-8H,1-4H2
InChI key:InChIKey=ZRNDQNUQJDTZKO-UHFFFAOYSA-N
SMILES:C(CCC(=C)Cl)C1=CC=C(F)C=C1
Synonyms:
  • 1-(4-Chloro-4-penten-1-yl)-4-fluorobenzene
  • Benzene, 1-(4-chloro-4-penten-1-yl)-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.