CymitQuimica logo

CAS 1143461-61-3

:

1-(4-Bromo-4-penten-1-yl)-4-fluorobenzene

Description:
1-(4-Bromo-4-penten-1-yl)-4-fluorobenzene, identified by its CAS number 1143461-61-3, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring. The structure features a pentenyl group, which introduces a double bond into the molecule, contributing to its reactivity and potential applications in organic synthesis. The bromine atom, being a good leaving group, enhances the compound's utility in nucleophilic substitution reactions, while the fluorine atom can influence the electronic properties and stability of the aromatic system. This compound may exhibit unique physical properties, such as solubility in organic solvents and specific melting and boiling points, influenced by its molecular structure. Additionally, its reactivity profile makes it a candidate for various chemical transformations, including cross-coupling reactions and functionalization processes. Overall, 1-(4-Bromo-4-penten-1-yl)-4-fluorobenzene is of interest in the fields of medicinal chemistry and materials science due to its potential applications in the development of new pharmaceuticals and advanced materials.
Formula:C11H12BrF
InChI:InChI=1S/C11H12BrF/c1-9(12)3-2-4-10-5-7-11(13)8-6-10/h5-8H,1-4H2
InChI key:InChIKey=YFIBWWWKAXFSHA-UHFFFAOYSA-N
SMILES:C(CCC(Br)=C)C1=CC=C(F)C=C1
Synonyms:
  • 1-(4-Bromo-4-penten-1-yl)-4-fluorobenzene
  • Benzene, 1-(4-bromo-4-penten-1-yl)-4-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.