CAS 1143461-65-7

1-(4-Bromo-4-penten-1-yl)-3-methoxybenzene

Description:

1-(4-Bromo-4-penten-1-yl)-3-methoxybenzene, also known by its CAS number 1143461-65-7, is an organic compound characterized by the presence of a methoxy group and a brominated alkenyl substituent on a benzene ring. The structure features a methoxy group (-OCH3) attached to the meta position of the benzene, while a 4-bromo-4-penten-1-yl group, which includes a bromine atom and a pentene chain, is attached to the para position. This compound is likely to exhibit properties typical of both aromatic compounds and alkenes, such as stability due to resonance and potential reactivity due to the presence of the double bond and bromine substituent. It may participate in electrophilic aromatic substitution reactions and can undergo various organic transformations, including cross-coupling reactions and addition reactions at the double bond. The presence of the bromine atom may also impart unique reactivity and solubility characteristics, making it of interest in synthetic organic chemistry and potentially in materials science or medicinal chemistry applications.

Formula: C₁₂H₁₅BrO

InChI: InChI=1S/C12H15BrO/c1-10(13)5-3-6-11-7-4-8-12(9-11)14-2/h4,7-9H,1,3,5-6H2,2H3

InChI key: InChIKey=GLANSEBPJHTHPA-UHFFFAOYSA-N

SMILES: C(CCC(Br)=C)C1=CC(OC)=CC=C1

Synonyms:

• 1-(4-Bromo-4-penten-1-yl)-3-methoxybenzene
• Benzene, 1-(4-bromo-4-penten-1-yl)-3-methoxy-