CAS 1143461-67-9

1-(4-Chloro-4-penten-1-yl)-4-methoxybenzene

Description:

1-(4-Chloro-4-penten-1-yl)-4-methoxybenzene, also known by its CAS number 1143461-67-9, is an organic compound characterized by its unique structure, which includes a methoxy group and a chloro-substituted pentene chain. This compound features a benzene ring substituted at the para position with a methoxy group and at the ortho position with a 4-chloro-4-penten-1-yl group. The presence of the chloro group introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group contributes to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. Additionally, the unsaturated pentene moiety can participate in further chemical transformations, such as polymerization or addition reactions. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, this compound's structure suggests potential applications in organic synthesis and materials science.

Formula: C₁₂H₁₅ClO

InChI: InChI=1S/C12H15ClO/c1-10(13)4-3-5-11-6-8-12(14-2)9-7-11/h6-9H,1,3-5H2,2H3

InChI key: InChIKey=MZCDYMDBQFXACG-UHFFFAOYSA-N

SMILES: C(CCC(=C)Cl)C1=CC=C(OC)C=C1

Synonyms:

• Benzene, 1-(4-chloro-4-penten-1-yl)-4-methoxy-
• 1-(4-Chloro-4-penten-1-yl)-4-methoxybenzene