CymitQuimica logo

CAS 1143461-68-0

:

1-(4-Bromo-4-penten-1-yl)-4-methoxybenzene

Description:
1-(4-Bromo-4-penten-1-yl)-4-methoxybenzene, identified by its CAS number 1143461-68-0, is an organic compound characterized by the presence of both a brominated alkene and a methoxy-substituted aromatic ring. The structure features a 4-bromo-4-penten-1-yl group, which contributes to its reactivity and potential applications in organic synthesis, particularly in coupling reactions or as a building block for more complex molecules. The methoxy group on the aromatic ring enhances its electron-donating properties, influencing the compound's reactivity and solubility in various solvents. This compound may exhibit interesting physical properties such as moderate volatility and solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the presence of the bromine atom can facilitate further functionalization through nucleophilic substitution reactions. Overall, 1-(4-Bromo-4-penten-1-yl)-4-methoxybenzene is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C12H15BrO
InChI:InChI=1S/C12H15BrO/c1-10(13)4-3-5-11-6-8-12(14-2)9-7-11/h6-9H,1,3-5H2,2H3
InChI key:InChIKey=OJGVMPSFKRKZBV-UHFFFAOYSA-N
SMILES:C(CCC(Br)=C)C1=CC=C(OC)C=C1
Synonyms:
  • 1-(4-Bromo-4-penten-1-yl)-4-methoxybenzene
  • Benzene, 1-(4-bromo-4-penten-1-yl)-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.