CymitQuimica logo

CAS 114373-05-6

:

1-BENZYL-3-METHYL-PYRROLIDINE-3-CARBONITRILE

Description:
1-Benzyl-3-methyl-pyrrolidine-3-carbonitrile is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a benzyl group and a carbonitrile functional group contributes to its unique properties. This compound typically exhibits moderate polarity due to the electronegative nitrogen and the cyano group, which can influence its solubility in various solvents. It may also display basicity due to the nitrogen atom in the pyrrolidine ring. The carbonitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions, making it a versatile intermediate in organic synthesis. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its structural features that can interact with biological targets. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H16N2
InChI:InChI=1/C13H16N2/c1-13(10-14)7-8-15(11-13)9-12-5-3-2-4-6-12/h2-6H,7-9,11H2,1H3
Synonyms:
  • 3-Methyl-1-(phenylmethyl)-3-pyrrolidinecarbonitrile
  • 1-BENZYL-3-METHYL-PYRROLIDINE-3-CARBONITRILE
  • 3-Pyrrolidinecarbonitrile, 3-methyl-1-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.