CAS 114373-08-9: N,N,3-Trimethyl-3-pyrrolidinemethanamine

Description:N,N,3-Trimethyl-3-pyrrolidinemethanamine, with the CAS number 114373-08-9, is an organic compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound is a tertiary amine, meaning it has three alkyl groups attached to the nitrogen atom, contributing to its basicity and nucleophilicity. The presence of the trimethyl groups enhances its steric bulk, which can influence its reactivity and interactions with other molecules. Typically, such compounds exhibit solubility in polar organic solvents due to the presence of the nitrogen atom, which can engage in hydrogen bonding. N,N,3-Trimethyl-3-pyrrolidinemethanamine may be utilized in various applications, including as a building block in organic synthesis or in the development of pharmaceuticals. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular environment and substituents present. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₈H₁₈N₂

InChI:InChI=1S/C8H18N2/c1-8(7-10(2)3)4-5-9-6-8/h9H,4-7H2,1-3H3

InChI key:InChIKey=OIMODVBOSLWPFV-UHFFFAOYSA-N

SMILES:N1CCC(C)(C1)CN(C)C

Synonyms:
N,N,3-Trimethyl-3-pyrrolidinemethanamine
3-Pyrrolidinemethanamine, N,N,3-trimethyl-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Dimethyl[(3-methylpyrrolidin-3-yl)methyl]amine REF: 10-F660252CAS: 114373-08-9	98%	- - -	Discontinued product
	Dimethyl[(3-methylpyrrolidin-3-yl)methyl]amine REF: 3D-PEA37308CAS: 114373-08-9	Min. 95%	- - -	Discontinued product