CAS 1144-20-3

2-Phenylquinolin-4-ol

Description:

2-Phenylquinolin-4-ol, with the CAS number 1144-20-3, is an organic compound that belongs to the class of quinolines, which are bicyclic aromatic compounds. This substance features a phenyl group attached to the quinoline structure, specifically at the 2-position, and a hydroxyl group (-OH) at the 4-position, contributing to its classification as a phenolic compound. It typically appears as a solid at room temperature and is characterized by its aromatic nature, which imparts stability and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and can influence its reactivity, making it a candidate for various chemical reactions, including those involving hydrogen bonding. 2-Phenylquinolin-4-ol has garnered interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its synthesis can involve multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.

Formula: C₁₅H₁₁NO

InChI: InChI=1/C15H11NO/c17-15-10-14(11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)15/h1-10H,(H,16,17)

SMILES: c1ccc(cc1)c1cc(=O)c2ccccc2[nH]1

Synonyms:

• 4-Hydroxy-2-phenylquinoline
• 2-phenylquinolin-4(1H)-one

2-Phenylquinolin-4-ol

CAS: 1144-20-3

Formula: C₁₅H₁₁NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 221.2539

Ref: IN-DA000B8R

4-Hydroxy-2-phenylquinoline

CAS: 1144-20-3

4-Hydroxy-2-phenylquinoline

Formula: C₁₅H₁₁NO

Purity: ≥95%

Color and Shape: light brown powder

Molecular weight: 221.25g/mol

Ref: 54-OR309297

4-Hydroxy-2-phenylquinoline

Controlled Product

CAS: 1144-20-3

Applications 4-Hydroxy-2-phenylquinoline (cas# 1144-20-3) is a useful bacterial efflux pump inhibitor.
References Duraes, F., et al.: Curr. Med. Chem., 25, 6030 (2018)

Formula: C₁₅H₁₁NO

Color and Shape: Neat

Molecular weight: 221.26

Ref: TR-H113205