CymitQuimica logo

CAS 114402-92-5

:

5(or6)-Benzimidazoleaceticacid,2-methyl-(6CI)

Description:
5(or 6)-Benzimidazoleacetic acid, 2-methyl- (6CI), with the CAS number 114402-92-5, is a chemical compound characterized by its benzimidazole core structure, which is a bicyclic compound containing a fused benzene and imidazole ring. This compound features an acetic acid functional group, contributing to its acidic properties, and a methyl group at the second position of the benzimidazole ring. The presence of these functional groups suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The compound may exhibit biological activity, including antimicrobial or anti-inflammatory properties, due to the structural characteristics of the benzimidazole moiety. Additionally, its solubility and stability in various solvents can influence its reactivity and potential uses in synthesis or as a reagent in chemical reactions. As with many benzimidazole derivatives, it may also serve as a scaffold for further chemical modifications to enhance its therapeutic efficacy or selectivity.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c1-6-11-8-3-2-7(5-10(13)14)4-9(8)12-6/h2-4H,5H2,1H3,(H,11,12)(H,13,14)
SMILES:Cc1nc2ccc(cc2[nH]1)CC(=O)O
Synonyms:
  • (2-methyl-1H-benzimidazol-6-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.