CymitQuimica logo

CAS 1144080-29-4

:

1,4-Dioxaspiro[4.5]dec-8-ylhydrazine

Description:
1,4-Dioxaspiro[4.5]dec-8-ylhydrazine is a chemical compound characterized by its unique spirocyclic structure, which incorporates a dioxane moiety and a hydrazine functional group. This compound features a bicyclic framework that contributes to its rigidity and potential for specific interactions in biological systems. The presence of the hydrazine group suggests reactivity, particularly in forming hydrazones or undergoing oxidation reactions. Its molecular structure may impart interesting properties, such as solubility in various organic solvents and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 1144080-29-4, allows for precise identification in chemical databases. While specific physical properties like melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit moderate stability under standard conditions but may require careful handling due to the reactivity associated with hydrazine derivatives. Overall, 1,4-Dioxaspiro[4.5]dec-8-ylhydrazine represents a class of compounds with potential utility in various chemical and biological applications.
Formula:C8H16N2O2
InChI:InChI=1S/C8H16N2O2/c9-10-7-1-3-8(4-2-7)11-5-6-12-8/h7,10H,1-6,9H2
InChI key:InChIKey=QEPOUWFTAJMFDQ-UHFFFAOYSA-N
SMILES:N(N)C1CCC2(CC1)OCCO2
Synonyms:
  • Hydrazine, 1,4-dioxaspiro[4.5]dec-8-yl-
  • 1,4-Dioxaspiro[4.5]dec-8-ylhydrazine
  • 1,4-Dioxaspiro[4.5]decan-8-ylhydrazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.