CAS 1144080-31-8
:4,6-Dichloro-1-(1,4-dioxaspiro[4.5]dec-8-yl)-1H-pyrazolo[3,4-d]pyrimidine
Description:
4,6-Dichloro-1-(1,4-dioxaspiro[4.5]dec-8-yl)-1H-pyrazolo[3,4-d]pyrimidine is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrazolo-pyrimidine core and a spirocyclic moiety. The presence of two chlorine atoms at the 4 and 6 positions of the pyrimidine ring contributes to its reactivity and potential biological activity. The 1,4-dioxaspiro structure introduces unique steric and electronic properties, which may influence the compound's interactions with biological targets. This compound is likely to exhibit solubility in organic solvents, and its stability can be affected by environmental conditions such as pH and temperature. Due to its structural features, it may possess pharmacological properties, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, bioactivity, and applications would require further investigation through experimental studies and literature reviews. Overall, this compound represents a class of heterocyclic compounds that are often explored for their potential therapeutic applications.
Formula:C13H14Cl2N4O2
InChI:InChI=1S/C13H14Cl2N4O2/c14-10-9-7-16-19(11(9)18-12(15)17-10)8-1-3-13(4-2-8)20-5-6-21-13/h7-8H,1-6H2
InChI key:InChIKey=NBPHZZVDIJRLQC-UHFFFAOYSA-N
SMILES:ClC1=C2C(N(N=C2)C3CCC4(CC3)OCCO4)=NC(Cl)=N1
Synonyms:- 4,6-Dichloro-1-(1,4-dioxaspiro[4.5]dec-8-yl)-1H-pyrazolo[3,4-d]pyrimidine
- 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-1-(1,4-dioxaspiro[4.5]dec-8-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.