
CAS 1144110-17-7
:2-Bromo-5-(2-methylpropoxy)pyridine
Description:
2-Bromo-5-(2-methylpropoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a 2-methylpropoxy group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, reflecting its hydrophobic characteristics due to the alkyl group. The bromine substituent can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the pyridine ring can engage in various chemical reactions, including electrophilic aromatic substitution. The compound may exhibit biological activity, which is common for substituted pyridines, and could be of interest in pharmaceutical research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-5-(2-methylpropoxy)pyridine is a versatile compound with potential applications in organic chemistry and medicinal chemistry.
Formula:C9H12BrNO
InChI:InChI=1S/C9H12BrNO/c1-7(2)6-12-8-3-4-9(10)11-5-8/h3-5,7H,6H2,1-2H3
InChI key:InChIKey=OHKSWILVIOGZMI-UHFFFAOYSA-N
SMILES:O(CC(C)C)C=1C=CC(Br)=NC1
Synonyms:- 2-Bromo-5-isobutoxy-pyridine
- 2-Bromo-5-(2-methylpropoxy)pyridine
- 2-Bromo-5-isobutoxypyridine
- Bromo-5-isobutoxypyridine
- Pyridine, 2-bromo-5-(2-methylpropoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.