CymitQuimica logo

CAS 1144113-17-6

:

2,5,8,11,14,17,20,23-Octaoxapentacosan-25-ol, 1-phenyl-, 25-(4-methylbenzenesulfonate)

Description:
2,5,8,11,14,17,20,23-Octaoxapentacosan-25-ol, 1-phenyl-, 25-(4-methylbenzenesulfonate) is a complex organic compound characterized by its long-chain structure, which includes multiple ether linkages due to the presence of eight oxygen atoms in its backbone. This compound features a phenyl group and a sulfonate moiety, which contribute to its solubility and reactivity. The presence of the sulfonate group enhances its potential as a surfactant or emulsifying agent, making it useful in various applications, including pharmaceuticals and materials science. The long aliphatic chain may impart hydrophobic characteristics, while the polar functional groups provide hydrophilicity, allowing for amphiphilic behavior. Its molecular structure suggests potential applications in drug delivery systems, where solubility and stability in biological environments are crucial. Additionally, the compound's unique properties may be explored in the development of novel materials or as a reagent in organic synthesis. However, specific safety and handling guidelines should be followed due to the complexity and potential reactivity of such compounds.
Formula:C30H46O11S
InChI:InChI=1S/C30H46O11S/c1-28-7-9-30(10-8-28)42(31,32)41-26-25-39-22-21-37-18-17-35-14-13-33-11-12-34-15-16-36-19-20-38-23-24-40-27-29-5-3-2-4-6-29/h2-10H,11-27H2,1H3
InChI key:InChIKey=JZRYNAITFJTHLY-UHFFFAOYSA-N
SMILES:S(OCCOCCOCCOCCOCCOCCOCCOCCOCC1=CC=CC=C1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:
  • 2,5,8,11,14,17,20,23-Octaoxapentacosan-25-ol, 1-phenyl-, 25-(4-methylbenzenesulfonate)
  • Octaethylene glycol monobenzyl ether tosylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Benzyl-PEG8-Ots

    CAS:
    <p>Benzyl-PEG8-Ots is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.</p>
    Formula:C30H46O11S
    Color and Shape:Solid
    Molecular weight:614.75