CymitQuimica logo

CAS 114412-66-7

:

1-[(2R,5S)-Tetrahydro-5-(hydroxymethyl)-2-furanyl]-1H-1,2,4-triazole-3-carboxamide

Description:
1-[(2R,5S)-Tetrahydro-5-(hydroxymethyl)-2-furanyl]-1H-1,2,4-triazole-3-carboxamide is a chemical compound characterized by its unique structural features, including a triazole ring and a furan moiety. The presence of the hydroxymethyl group contributes to its potential solubility and reactivity. This compound is often studied for its biological activity, particularly in the context of pharmaceuticals, where it may exhibit antimicrobial or antifungal properties. The stereochemistry indicated by the (2R,5S) configuration suggests specific spatial arrangements that can influence the compound's interaction with biological targets. Additionally, the carboxamide functional group enhances its ability to form hydrogen bonds, which can be crucial for its activity and stability. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry due to their diverse applications and potential therapeutic effects. Further research is typically required to fully elucidate its properties and mechanisms of action.
Formula:C8H12N4O3
InChI:InChI=1S/C8H12N4O3/c9-7(14)8-10-4-12(11-8)6-2-1-5(3-13)15-6/h4-6,13H,1-3H2,(H2,9,14)/t5-,6+/m0/s1
InChI key:InChIKey=CEQVBLRXFOWHHO-NTSWFWBYSA-N
SMILES:C(N)(=O)C1=NN(C=N1)[C@@H]2O[C@H](CO)CC2
Synonyms:
  • 1H-1,2,4-Triazole-3-carboxamide, 1-[tetrahydro-5-(hydroxymethyl)-2-furanyl]-, (2R-cis)-
  • 1H-1,2,4-Triazole-3-carboxamide, 1-[(2R,5S)-tetrahydro-5-(hydroxymethyl)-2-furanyl]-
  • 1-[(2R,5S)-Tetrahydro-5-(hydroxymethyl)-2-furanyl]-1H-1,2,4-triazole-3-carboxamide
  • 2′,3′-Dideoxyribavirin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.