CymitQuimica logo

CAS 114414-17-4

:

2-Amino-3-hydroxy-4-bromopyridine HBr

Description:
2-Amino-3-hydroxy-4-bromopyridine HBr is a chemical compound characterized by its pyridine ring, which is substituted with an amino group, a hydroxyl group, and a bromine atom. This compound is typically encountered as a hydrobromide salt, enhancing its solubility in polar solvents. The presence of the amino and hydroxyl groups contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent can serve as a site for further chemical modifications, making it useful in various synthetic pathways. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its molecular structure allows for hydrogen bonding, influencing its physical properties such as melting point and solubility. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 2-Amino-3-hydroxy-4-bromopyridine HBr is a significant compound in the realm of organic chemistry and drug development.
Formula:C5H6Br2N2O
InChI:InChI=1/C5H5BrN2O.BrH/c6-3-1-2-8-5(7)4(3)9;/h1-2,9H,(H2,7,8);1H
InChI key:AZDPXMBYUFHXAN-UHFFFAOYSA-N
SMILES:c1c[nH]c(=N)c(c1Br)O.Br
Synonyms:
  • 2-Amino-3-hydroxy-4-bromopyridine hydrobromide
  • 2-Amino-4-bromo-3-hydroxypyridine HBr
Found 4 products.