
CAS 114415-26-8
:5-Dodecyl-2-[4-(octyloxy)phenyl]pyrimidine
Description:
5-Dodecyl-2-[4-(octyloxy)phenyl]pyrimidine is an organic compound characterized by its complex structure, which includes a pyrimidine ring substituted with a dodecyl chain and a phenyl group that is further substituted with an octyloxy group. This compound exhibits amphiphilic properties due to the presence of both hydrophobic (dodecyl and octyloxy chains) and hydrophilic (pyrimidine ring) components, making it potentially useful in applications such as surfactants, emulsifiers, or in the formulation of liquid crystals. The long alkyl chains contribute to its solubility in organic solvents, while the pyrimidine moiety may participate in hydrogen bonding and π-π interactions, influencing its behavior in various chemical environments. Additionally, the presence of the octyloxy group can enhance its stability and solubility in non-polar solvents. Overall, this compound's unique structural features suggest potential utility in materials science and organic synthesis, particularly in the development of functionalized materials or as intermediates in chemical reactions.
Formula:C30H48N2O
InChI:InChI=1S/C30H48N2O/c1-3-5-7-9-11-12-13-14-15-17-19-27-25-31-30(32-26-27)28-20-22-29(23-21-28)33-24-18-16-10-8-6-4-2/h20-23,25-26H,3-19,24H2,1-2H3
InChI key:InChIKey=DIESLOGOXULNIV-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)C=1C=NC(=NC1)C2=CC=C(OCCCCCCCC)C=C2
Synonyms:- Pyrimidine, 5-dodecyl-2-[4-(octyloxy)phenyl]-
- 5-Dodecyl-2-[4-(octyloxy)phenyl]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
