CAS 114420-66-5
:Regaloside A
Description:
Regaloside A, with the CAS number 114420-66-5, is a natural compound classified as a glycoside, specifically a type of saponin. It is primarily derived from the plant species *Regalecus glesne*, known for its potential medicinal properties. This compound is characterized by its complex structure, which typically includes a sugar moiety linked to a steroid or triterpenoid aglycone. Regaloside A has garnered interest in pharmacological research due to its reported bioactivities, including anti-inflammatory, antioxidant, and potential anticancer effects. Its solubility properties can vary, often being more soluble in polar solvents, which is common for glycosides. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many natural products, the extraction and purification processes are crucial for obtaining Regaloside A in a form suitable for research and potential therapeutic applications. Further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C18H24O10
InChI:InChI=1S/C18H24O10/c19-7-13-15(23)16(24)17(25)18(28-13)27-9-12(21)8-26-14(22)6-3-10-1-4-11(20)5-2-10/h1-6,12-13,15-21,23-25H,7-9H2/b6-3+/t12-,13-,15-,16+,17-,18-/m1/s1
InChI key:InChIKey=PADHSFRQMFRWLS-BFQBLSCMSA-N
SMILES:O(C[C@@H](COC(/C=C/C1=CC=C(O)C=C1)=O)O)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
Synonyms:- β-D-Glucopyranoside, (2S)-2-hydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]propyl
- Regaloside A
- β-D-Glucopyranoside, 2-hydroxy-3-[[3-(4-hydroxyphenyl)-1-oxo-2-propenyl]oxy]propyl, [S-(E)]-
- (2S)-2-Hydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]propyl β-D-glucopyranoside
- β-D-Glucopyranoside, (2S)-2-hydroxy-3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]propyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Regaloside A
CAS:Regaloside A is a phenylpropane derived from lily of the valley that shows DPPH free radical scavenging activity at 160 ppm.Regaloside A has anti-inflammatoryFormula:C18H24O10Purity:99.91%Color and Shape:SolidMolecular weight:400.38Regaloside A
CAS:Formula:C18H24O10Purity:≥ 98.0%Color and Shape:Off-white powderMolecular weight:400.38Regaloside A
CAS:Regaloside A is a glycoside compound, which is a naturally occurring molecule. It is sourced from certain plant species, where it forms as part of the plant's secondary metabolites. Regaloside A functions through its ability to modulate biological pathways, often impacting cellular processes like signal transduction or enzyme activity.
Formula:C18H24O10Purity:Min. 95%Molecular weight:400.4 g/mol




