CAS 114420-67-6
:(2S)-3-(acetyloxy)-2-(hexopyranosyloxy)propyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate
Description:
The chemical substance known as (2S)-3-(acetyloxy)-2-(hexopyranosyloxy)propyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate, with the CAS number 114420-67-6, is a complex organic compound characterized by its structural features that include multiple functional groups. It contains an acetyloxy group, which suggests it may have ester characteristics, and a hexopyranosyloxy moiety, indicating the presence of a sugar derivative that can influence its solubility and biological activity. The (2E)-3-(4-hydroxyphenyl)prop-2-enoate part of the molecule indicates that it has a phenolic component, which may contribute to antioxidant properties. The stereochemistry denoted by (2S) implies specific spatial arrangements of atoms, which can affect the compound's reactivity and interaction with biological systems. Overall, this compound may exhibit interesting pharmacological properties due to its structural complexity, making it a subject of interest in medicinal chemistry and natural product research. Its potential applications could range from therapeutic agents to functional food ingredients, depending on its bioactivity and stability.
Formula:C20H26O11
InChI:InChI=1/C20H26O11/c1-11(22)28-9-14(30-20-19(27)18(26)17(25)15(8-21)31-20)10-29-16(24)7-4-12-2-5-13(23)6-3-12/h2-7,14-15,17-21,23,25-27H,8-10H2,1H3/b7-4+/t14-,15?,17?,18?,19?,20?/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Regaloside B
CAS:Regaloside B, a phenylpropanoid isolated from Lilium longiflorum, exhibits anti-inflammatory activity by inhibiting the expression of iNOS (inducible nitricFormula:C20H26O11Purity:99.4% - 99.57%Color and Shape:SolidMolecular weight:442.41Ref: TM-TN2139
1mg69.00€5mg142.00€10mg220.00€25mg368.00€50mg540.00€100mg775.00€1mL*10mM (DMSO)To inquireRegaloside B
CAS:<p>Regaloside B is a pentacyclic triterpene that has been found to have antioxidant effects. It also inhibits the production of 5-hmf, an important mediator in the inflammatory response. Regaloside B has been shown to be effective in inhibiting cell morphology changes and mitochondrial membrane potential in various types of cells. The activity test for this compound is based on its ability to inhibit the production of nitric oxide (NO) and tumor necrosis factor-α (TNF-α). Chemical structures, fingerprint analysis, and biodegradability are some of the analytical methods used to identify Regaloside B.</p>Formula:C20H26O11Purity:Min. 95%Molecular weight:442.4 g/mol




