CAS 114423-97-1
:octachloro(~13~C_12_)oxanthrene
Description:
Octachloro(13C12)oxanthrene, with the CAS number 114423-97-1, is a synthetic organic compound characterized by its chlorinated aromatic structure. It features a central oxanthrene core, which is a polycyclic aromatic compound, heavily substituted with chlorine atoms. The presence of eight chlorine atoms significantly influences its physical and chemical properties, including increased stability and altered solubility compared to its non-chlorinated counterparts. This compound is typically solid at room temperature and may exhibit a high degree of hydrophobicity due to the chlorination. Its chlorinated nature can also impart unique electronic properties, making it of interest in various applications, including materials science and environmental studies. Additionally, the isotopic labeling with carbon-13 (13C) suggests its use in tracer studies or analytical applications, allowing for the investigation of its behavior in different chemical environments. Overall, octachloro(13C12)oxanthrene represents a complex and specialized compound within the realm of chlorinated organic chemicals.
Formula:C12Cl8O2
InChI:InChI=1/C12Cl8O2/c13-1-2(14)6(18)10-9(5(1)17)21-11-7(19)3(15)4(16)8(20)12(11)22-10/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
Synonyms:- Octachlorodibenzo-p-dioxin-13C12
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Octachlorodibenzo-p-dioxin-13C12
CAS:Controlled ProductFormula:C12Cl8O2Color and Shape:NeatMolecular weight:471.66
