CymitQuimica logo

CAS 114423-98-2

:

1,2,3,4,7,8-hexachloro(~13~C_12_)dibenzo[b,d]furan

Description:
1,2,3,4,7,8-Hexachloro(dibenzo[b,d]furan) is a synthetic organic compound characterized by its complex polycyclic structure and multiple chlorine substituents. This compound belongs to the class of polychlorinated dibenzo-furans, which are known for their environmental persistence and potential toxicity. The presence of six chlorine atoms significantly alters its physical and chemical properties, contributing to its hydrophobic nature and resistance to degradation. It is typically found as a solid at room temperature and may exhibit low volatility. The compound is of interest due to its potential as a pollutant and its implications in environmental chemistry, particularly concerning bioaccumulation and toxicological effects on wildlife and humans. Its stability and resistance to metabolic breakdown raise concerns regarding its long-term environmental impact. Additionally, the isotopic labeling with carbon-13 suggests applications in tracing studies or environmental monitoring. Overall, 1,2,3,4,7,8-hexachloro(dibenzo[b,d]furan) exemplifies the challenges posed by persistent organic pollutants in ecosystems.
Formula:13C12H2Cl6O
InChI:InChI=1/C12H2Cl6O/c13-4-1-3-6(2-5(4)14)19-12-7(3)8(15)9(16)10(17)11(12)18/h1-2H/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.