CAS 114429-07-1
:TERT-BUTYL-2-CYANONICOTINATE
Description:
Tert-Butyl-2-cyanonicotinate is an organic compound characterized by its structure, which includes a tert-butyl group and a cyano group attached to a nicotinic acid derivative. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its role in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. It features a pyridine ring, which contributes to its aromatic properties and potential reactivity. The presence of the cyano group enhances its utility in various chemical reactions, such as nucleophilic additions and as a building block in the synthesis of more complex molecules. Tert-butyl-2-cyanonicotinate is also noted for its moderate polarity, which can influence its solubility in different solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is valuable in synthetic chemistry due to its functional groups and structural characteristics.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-11(2,3)15-10(14)8-5-4-6-13-9(8)7-12/h4-6H,1-3H3
SMILES:CC(C)(C)OC(=O)c1cccnc1C#N
Synonyms:- Tert-Butyl-2-Cyanonictinate
- Tert-Butyl 2-Cyanopyridine-3-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
