CAS 114433-94-2
:1-(4-Fluorophenyl)-4-methylpentane-1,3-dione
Description:
1-(4-Fluorophenyl)-4-methylpentane-1,3-dione, with the CAS number 114433-94-2, is an organic compound characterized by its unique structure, which includes a fluorinated phenyl group and a diketone functional group. This compound typically exhibits a yellow to orange color in its solid state and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the fluorine atom enhances its chemical stability and can influence its reactivity, making it of interest in various synthetic applications. The diketone functional group suggests potential reactivity in condensation reactions, and it may serve as a precursor in the synthesis of more complex organic molecules. Additionally, the compound's structural features may impart specific biological activities, making it a candidate for research in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C12H13FO2
InChI:InChI=1/C12H13FO2/c1-8(2)11(14)7-12(15)9-3-5-10(13)6-4-9/h3-6,8H,7H2,1-2H3
SMILES:CC(C)C(=O)CC(=O)c1ccc(cc1)F
Synonyms:- 1,3-Pentanedione, 1-(4-Fluorophenyl)-4-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
