
CAS 114438-32-3
:4-(Hydroxyamino)-N-2-pyrimidinylbenzenesulfonamide
Description:
4-(Hydroxyamino)-N-2-pyrimidinylbenzenesulfonamide, with the CAS number 114438-32-3, is a chemical compound that features a sulfonamide functional group, which is known for its antibacterial properties. This compound contains a pyrimidine ring, a six-membered aromatic ring, and a hydroxyamino group, contributing to its potential biological activity. The presence of the sulfonamide moiety suggests that it may interact with enzymes or receptors in biological systems, potentially inhibiting certain metabolic pathways. The hydroxyamino group can participate in hydrogen bonding, influencing the compound's solubility and reactivity. Additionally, the pyrimidinyl group may enhance the compound's ability to interact with nucleic acids or proteins, making it of interest in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial agents or other therapeutic applications. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C10H10N4O3S
InChI:InChI=1S/C10H10N4O3S/c15-13-8-2-4-9(5-3-8)18(16,17)14-10-11-6-1-7-12-10/h1-7,13,15H,(H,11,12,14)
InChI key:InChIKey=BHNNTIGNLIYDOR-UHFFFAOYSA-N
SMILES:S(NC=1N=CC=CN1)(=O)(=O)C2=CC=C(NO)C=C2
Synonyms:- 4-(Hydroxyamino)-N-2-pyrimidinylbenzenesulfonamide
- Benzenesulfonamide, 4-(hydroxyamino)-N-2-pyrimidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(Hydroxyamino)-N-(pyrimidin-2-yl)benzenesulfonamide
CAS:Formula:C10H10N4O3SMolecular weight:266.2764
