
CAS 114438-35-6
:1-Ethyl 2,2-diphosphonoacetate
Description:
1-Ethyl 2,2-diphosphonoacetate, with the CAS number 114438-35-6, is a chemical compound that belongs to the class of organophosphorus compounds. It features a phosphonate functional group, which is characterized by the presence of phosphorus atoms bonded to oxygen and carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, such as water and alcohols, due to its polar nature. The presence of ethyl and diphosphonoacetate groups contributes to its reactivity and potential applications in various fields, including agriculture as a pesticide or herbicide, and in organic synthesis as a building block for more complex molecules. Additionally, 1-Ethyl 2,2-diphosphonoacetate may exhibit biological activity, making it of interest in medicinal chemistry. However, handling this compound requires caution due to potential toxicity associated with organophosphorus compounds. Proper safety measures should be observed when working with it in laboratory or industrial settings.
Formula:C4H10O8P2
InChI:InChI=1S/C4H10O8P2/c1-2-12-3(5)4(13(6,7)8)14(9,10)11/h4H,2H2,1H3,(H2,6,7,8)(H2,9,10,11)
InChI key:InChIKey=AULGFYDANADKBV-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(P(=O)(O)O)P(=O)(O)O
Synonyms:- Acetic acid, diphosphono-, 1-ethyl ester
- 1-Ethyl 2,2-diphosphonoacetate
- Acetic acid, 2,2-diphosphono-, 1-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
