CAS 114444-10-9
:2-(3-chlorophenyl)-3-oxo-3-(3-pyridyl)propanenitrile
Description:
2-(3-Chlorophenyl)-3-oxo-3-(3-pyridyl)propanenitrile, with the CAS number 114444-10-9, is a chemical compound characterized by its complex structure, which includes a chlorophenyl group, a pyridyl group, and a nitrile functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the chlorophenyl moiety may impart specific electronic effects, influencing its chemical behavior and solubility in various solvents. The nitrile group is known for its ability to participate in nucleophilic reactions, while the ketone functionality can engage in various chemical transformations, including condensation and reduction reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability, solubility, and reactivity can vary depending on the conditions, such as pH and temperature, which are crucial for applications in synthetic chemistry and drug development.
Formula:C14H9ClN2O
InChI:InChI=1/C14H9ClN2O/c15-12-5-1-3-10(7-12)13(8-16)14(18)11-4-2-6-17-9-11/h1-7,9,13H
SMILES:c1cc(cc(c1)Cl)C(C#N)C(=O)c1cccnc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Pyridinepropanenitrile, α-(3-chlorophenyl)-β-oxo-
CAS:Formula:C14H9ClN2OColor and Shape:SolidMolecular weight:256.68712-(3-Chlorophenyl)-2-cyano-1-(3-pyridinyl)-1-ethanone
CAS:Controlled ProductFormula:C14H9ClN2OColor and Shape:NeatMolecular weight:256.69

