CymitQuimica logo

CAS 114446-47-8

:

(R)-3-Chloro-1-phenyl-1-(2-methylphenoxy)propane

Description:
(R)-3-Chloro-1-phenyl-1-(2-methylphenoxy)propane is a chiral organic compound characterized by its specific stereochemistry, indicated by the (R) configuration. This compound features a chloro substituent at the third carbon of a propane chain, which is also bonded to a phenyl group and a 2-methylphenoxy group. The presence of the chlorine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The phenyl and 2-methylphenoxy groups contribute to the compound's hydrophobic characteristics, influencing its solubility in organic solvents and its potential applications in pharmaceuticals or agrochemicals. Additionally, the chirality of the molecule may affect its biological activity, as enantiomers can exhibit different behaviors in biological systems. The compound's molecular structure suggests it may participate in interactions with biological targets, making it of interest in medicinal chemistry. Overall, (R)-3-Chloro-1-phenyl-1-(2-methylphenoxy)propane is a complex molecule with unique properties stemming from its functional groups and stereochemistry.
Formula:C16H17ClO
InChI:InChI=1/C16H17ClO/c1-13-7-5-6-10-15(13)18-16(11-12-17)14-8-3-2-4-9-14/h2-10,16H,11-12H2,1H3/t16-/m1/s1
SMILES:Cc1ccccc1O[C@H](CCCl)c1ccccc1
Synonyms:
  • 1-[(1R)-3-Chloro-1-phenylpropoxy]-2-methylbenzene
  • (1R)-3-chloro-1-phenylpropyl 2-methylphenyl ether
  • (R)-3-Chloro-1-phenyl-1-(2-methylphenoxy)propane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.