CymitQuimica logo

CAS 114446-50-3

:

(S)-3-CHLORO-1-PHENYL-1-[2-METHYL-PHENOXYL]PROPANE

Description:
(S)-3-Chloro-1-phenyl-1-[2-methyl-phenoxyl]propane, with the CAS number 114446-50-3, is a chiral organic compound characterized by its specific stereochemistry, indicated by the (S) configuration. This compound features a chlorinated propane backbone, which contributes to its reactivity and potential applications in various chemical processes. The presence of a phenyl group and a 2-methyl-phenoxyl moiety enhances its hydrophobic characteristics, making it more soluble in organic solvents than in water. The chlorinated structure may also impart unique biological activities, which can be of interest in pharmaceutical research. Additionally, the compound's chirality suggests that it may exhibit different properties or activities compared to its enantiomer, which is significant in fields such as drug development where stereochemistry plays a crucial role in biological interactions. Overall, (S)-3-chloro-1-phenyl-1-[2-methyl-phenoxyl]propane is a compound of interest in organic synthesis and medicinal chemistry due to its structural features and potential applications.
Formula:C16H17ClO
InChI:InChI=1/C16H17ClO/c1-13-7-5-6-10-15(13)18-16(11-12-17)14-8-3-2-4-9-14/h2-10,16H,11-12H2,1H3/t16-/m0/s1
SMILES:Cc1ccccc1O[C@@H](CCCl)c1ccccc1
Synonyms:
  • 1-[(1S)-3-Chloro-1-phenylpropoxy]-2-methylbenzene
  • (1S)-3-chloro-1-phenylpropyl 2-methylphenyl ether
  • (S)-3-CHLORO-1-PHENYL-1-[2-METHYL-PHENOXYL]PROPANE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.