CAS 114451-08-0
:3-Methyl-2-nitro-3H-imidazo[4,5-F]quinoline
Description:
3-Methyl-2-nitro-3H-imidazo[4,5-F]quinoline is a heterocyclic organic compound characterized by its fused imidazole and quinoline rings, which contribute to its unique chemical properties. This compound features a methyl group and a nitro group, which influence its reactivity and potential biological activity. The presence of the nitro group can enhance its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. The imidazoquinoline structure is known for its potential pharmacological properties, including antimicrobial and anticancer activities. Additionally, the compound's molecular structure may exhibit planar characteristics, which can facilitate interactions with biological macromolecules. Its solubility and stability in various solvents can vary, affecting its application in research and industry. As with many nitro-containing compounds, it is essential to handle 3-Methyl-2-nitro-3H-imidazo[4,5-F]quinoline with care due to potential toxicity and environmental concerns. Overall, this compound represents a significant interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C11H8N4O2
InChI:InChI=1/C11H8N4O2/c1-14-9-5-4-8-7(3-2-6-12-8)10(9)13-11(14)15(16)17/h2-6H,1H3
SMILES:Cn1c2ccc3c(cccn3)c2nc1N(=O)=O
Synonyms:- 2-Nitro-3-methylimidazo[4,5-f]quinoline
- 3-Methyl-2-nitroimidazo[4,5-f]quinoline
- Nitro-I
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3H-Imidazo[4,5-f]quinoline, 3-methyl-2-nitro-
CAS:Formula:C11H8N4O2Color and Shape:SolidMolecular weight:228.2068
