CAS 114458-67-2
:N-Methyl-3-(phenylthio)-1-propanamine
Description:
N-Methyl-3-(phenylthio)-1-propanamine, identified by its CAS number 114458-67-2, is an organic compound characterized by the presence of a propanamine backbone with a methyl group and a phenylthio substituent. This compound features a nitrogen atom in its amine functional group, which contributes to its basicity and potential reactivity. The phenylthio group introduces a sulfur atom bonded to a phenyl ring, which can influence the compound's electronic properties and steric effects. N-Methyl-3-(phenylthio)-1-propanamine may exhibit moderate solubility in organic solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The presence of both the methyl and phenylthio groups can affect its interaction with biological targets, making it of interest for further research. As with many amines, it may also participate in hydrogen bonding, influencing its physical properties such as boiling point and melting point. Safety and handling precautions should be observed due to the potential toxicity associated with amines and sulfur-containing compounds.
Formula:C10H15NS
InChI:InChI=1S/C10H15NS/c1-11-8-5-9-12-10-6-3-2-4-7-10/h2-4,6-7,11H,5,8-9H2,1H3
InChI key:InChIKey=JTKPZAFRQHLJTA-UHFFFAOYSA-N
SMILES:S(CCCNC)C1=CC=CC=C1
Synonyms:- N-Methyl-3-(phenylthio)-1-propanamine
- 1-Propanamine, N-methyl-3-(phenylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
