
CAS 114460-15-0
:2-Propanol, 1-[4-(hydroxyamino)phenoxy]-3-[(1-methylethyl)amino]-, ethanedioate (1:1)
Description:
2-Propanol, 1-[4-(hydroxyamino)phenoxy]-3-[(1-methylethyl)amino]-, ethanedioate (1:1), with CAS number 114460-15-0, is a chemical compound characterized by its complex structure, which includes a propanol backbone and functional groups such as hydroxyamino and phenoxy. This compound typically exhibits properties associated with both alcohols and amines, including potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of hydroxyl and amino groups. The ethanedioate component suggests the presence of a carboxylate moiety, which may influence its reactivity and interactions in biological systems. The compound may have applications in pharmaceuticals or biochemistry, particularly in contexts where its specific functional groups can interact with biological targets. Its stability, reactivity, and potential toxicity would depend on the specific conditions of use and the presence of other chemical species. As with any chemical, proper handling and safety protocols should be observed to mitigate any risks associated with its use.
Formula:C12H20N2O3·C2H2O4
InChI:InChI=1S/C12H20N2O3.C2H2O4/c1-9(2)13-7-11(15)8-17-12-5-3-10(14-16)4-6-12;3-1(4)2(5)6/h3-6,9,11,13-16H,7-8H2,1-2H3;(H,3,4)(H,5,6)
InChI key:InChIKey=OQZQWKLDWJMFRS-UHFFFAOYSA-N
SMILES:O(CC(CNC(C)C)O)C1=CC=C(NO)C=C1.C(C(O)=O)(O)=O
Synonyms:- 2-Propanol, 1-[4-(hydroxyamino)phenoxy]-3-[(1-methylethyl)amino]-, ethanedioate (1:1) (salt)
- 2-Propanol, 1-[4-(hydroxyamino)phenoxy]-3-[(1-methylethyl)amino]-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propanol, 1-[4-(hydroxyamino)phenoxy]-3-[(1-methylethyl)amino]-, ethanedioate (1:1)
CAS:Formula:C14H22N2O7Molecular weight:330.3337
