
CAS 114460-23-0
:1-Hexadecanamine, N-ethyl-, hydrobromide (1:1)
Description:
1-Hexadecanamine, N-ethyl-, hydrobromide (1:1) is a quaternary ammonium compound characterized by its long hydrophobic hydrocarbon chain, which consists of 16 carbon atoms, and an ethyl group attached to the nitrogen atom. This structure imparts both hydrophobic and hydrophilic properties, making it amphiphilic. The hydrobromide salt form indicates that it is a protonated amine, enhancing its solubility in polar solvents, such as water. This compound is typically used in various applications, including surfactants, emulsifiers, and as a potential intermediate in organic synthesis. Its long alkyl chain contributes to its surface-active properties, while the ethyl substitution can influence its biological activity and interaction with cellular membranes. Safety data should be consulted, as amines can be irritants, and proper handling procedures should be followed to mitigate any risks associated with exposure. Overall, 1-Hexadecanamine, N-ethyl-, hydrobromide is notable for its unique balance of hydrophobic and hydrophilic characteristics, making it useful in both industrial and research settings.
Formula:C18H39N·BrH
InChI:InChI=1S/C18H39N.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-4-2;/h19H,3-18H2,1-2H3;1H
InChI key:InChIKey=ULLMKXUXGKCHGH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)CCCCCCNCC.Br
Synonyms:- 1-Hexadecanamine, N-ethyl-, hydrobromide (1:1)
- 1-Hexadecanamine, N-ethyl-, hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
