CymitQuimica logo

CAS 114462-77-0

:

METHYL 1-(4-CHLOROPHENYL)-5-(2-METHOXY-2-OXOETHYL)-1H-1,2,3-TRIAZOLE-4-CARBOXYLATE

Description:
Methyl 1-(4-chlorophenyl)-5-(2-methoxy-2-oxoethyl)-1H-1,2,3-triazole-4-carboxylate, identified by CAS number 114462-77-0, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a carboxylate functional group, contributing to its potential as a bioactive molecule. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity, while the methoxy-oxoethyl substituent can affect its solubility and reactivity. Compounds of this nature are often studied for their potential applications in pharmaceuticals, particularly as antifungal or antibacterial agents, due to the triazole moiety's known efficacy in these areas. Additionally, the structural characteristics suggest that it may exhibit interesting interactions with biological targets, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H12ClN3O4
InChI:InChI=1/C13H12ClN3O4/c1-20-11(18)7-10-12(13(19)21-2)15-16-17(10)9-5-3-8(14)4-6-9/h3-6H,7H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.