CAS 114466-38-5
:SERMORELIN ACETATE
Description:
Sermorelin acetate is a synthetic peptide that functions as a growth hormone-releasing hormone (GHRH) analog. It is composed of 29 amino acids and is primarily used in clinical settings to stimulate the secretion of growth hormone from the pituitary gland. The substance is characterized by its ability to promote growth and development, making it relevant in the treatment of growth hormone deficiency in children and adults. Sermorelin acetate is typically administered via subcutaneous injection and has a relatively short half-life, necessitating multiple doses for sustained effects. Its mechanism of action involves binding to specific receptors in the pituitary gland, leading to increased endogenous growth hormone production. While generally well-tolerated, potential side effects may include injection site reactions, flushing, and transient changes in blood pressure. As a research chemical, it is also studied for its potential benefits in anti-aging therapies and muscle wasting conditions. However, its use should be monitored by healthcare professionals to ensure safety and efficacy.
Formula:C149H246N44O42S
InChI:InChI=1/C149H246N44O42S/c1-20-77(13)116(191-122(211)81(17)168-132(221)104(66-113(204)205)178-121(210)79(15)167-123(212)88(152)62-84-39-43-86(198)44-40-84)145(234)185-102(63-83-32-23-22-24-33-83)138(227)193-118(82(18)197)146(235)186-103(65-111(155)202)137(226)189-108(71-196)142(231)182-101(64-85-41-45-87(199)46-42-85)136(225)175-93(38-31-56-165-149(161)162)126(215)174-91(35-26-28-53-151)131(220)190-115(76(11)12)143(232)184-97(58-72(3)4)124(213)166-68-112(203)170-94(47-49-109(153)200)128(217)180-100(61-75(9)10)135(224)188-106(69-194)140(229)169-80(16)120(209)172-92(37-30-55-164-148(159)160)125(214)173-90(34-25-27-52-150)127(216)179-99(60-74(7)8)134(223)181-98(59-73(5)6)133(222)176-95(48-50-110(154)201)129(218)183-105(67-114(206)207)139(228)192-117(78(14)21-2)144(233)177-96(51-57-236-19)130(219)187-107(70-195)141(230)171-89(119(156)208)36-29-54-163-147(157)158/h22-24,32-33,39-46,72-82,88-108,115-118,194-199H,20-21,25-31,34-38,47-71,150-152H2,1-19H3,(H2,153,200)(H2,154,201)(H2,155,202)(H2,156,208)(H,166,213)(H,167,212)(H,168,221)(H,169,229)(H,170,203)(H,171,230)(H,172,209)(H,173,214)(H,174,215)(H,175,225)(H,176,222)(H,177,233)(H,178,210)(H,179,216)(H,180,217)(H,181,223)(H,182,231)(H,183,218)(H,184,232)(H,185,234)(H,186,235)(H,187,219)(H,188,224)(H,189,226)(H,190,220)(H,191,211)(H,192,228)(H,193,227)(H,204,205)(H,206,207)(H4,157,158,163)(H4,159,160,164)(H4,161,162,165)/t77-,78-,79-,80-,81-,82+,88-,89-,90-,91-,92-,93-,94-,95-,96-,97-,98-,99-,100-,101-,102-,103-,104-,105-,106-,107-,108-,115-,116-,117-,118-/m0/s1
Synonyms:- Sermelin Acetate
- 29-L-Argininamide-30-de-L-glutamine-31-de-L-glutamine-32-deglycine-33-de-L-glutamic acid-34-de-L-serine-35-de-L-asparagine-36-de-L-glutamine-37-de-L-glutamic acid-38-de-L-arginine-39-deglycine-40-de-L-alanine-41-de-L-arginine-42-de-L-alanine-43-de-L-arginine-44-de-L-leucinamidegrowth hormone-releasing factor (human pancreatic islet), acetate (salt), hydrate
- Geref
- Growth hormone-releasing factor (human)-(1-29)-peptide amide, acetate (salt), hydrate
- Unii-00Ibg87Iqw
- Somatoliberin (human pancreatic islet), 29-L-argininamide-30-de-L-glutamine-31-de-L-glutamine-32-deglycine-33-de-L-glutamic acid-34-de-L-serine-35-de-L-asparagine-36-de-L-glutamine-37-de-L-glutamic acid-38-de-L-arginine-39-deglycine-40-de-L-alanine-41-de-L-arginine-42-de-L-alanine-43-de-L-arginine-44-de-L-leucinamide-, acetate (salt), hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Sermorelin acetate hydrate
CAS:Formula:C151H252N44O45SColor and Shape:SolidMolecular weight:3435.9494Sermorelin Acetate
CAS:Formula:C149H246N44O42SPurity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:3357.88Sermorelin acetate
CAS:Controlled Product<p>Sermorelin acetate is a synthetic peptide, which is an analogue of the naturally occurring growth hormone-releasing hormone (GHRH). It is derived from recombinant DNA technology, representing the first 29 amino acids (1-29) of endogenous GHRH. Its mode of action involves binding to and activating the GHRH receptor on the anterior pituitary gland, which subsequently stimulates the release of growth hormone (GH) into the bloodstream.</p>Formula:C149H246N44O42S·C2H4O2Purity:Min. 95%Molecular weight:3,417.94 g/mol



