CAS 114468-04-1: 3-Bromo-5-(difluoromethyl)pyridine

Description:3-Bromo-5-(difluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 3-position and a difluoromethyl group at the 5-position. This compound features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of the bromine atom introduces electrophilic characteristics, making it useful in various synthetic applications, including medicinal chemistry and agrochemicals. The difluoromethyl group enhances the lipophilicity and metabolic stability of the compound, which can influence its biological activity. 3-Bromo-5-(difluoromethyl)pyridine is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. Its unique structural features make it a valuable intermediate in the synthesis of more complex molecules, and it may exhibit interesting pharmacological properties, warranting further investigation in drug development. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.

Formula:C₆H₄BrF₂N

InChI:InChI=1S/C6H4BrF2N/c7-5-1-4(6(8)9)2-10-3-5/h1-3,6H

InChI key:InChIKey=YEIYXHOMHKPBGQ-UHFFFAOYSA-N

SMILES:FC(F)C=1C=NC=C(Br)C1

Synonyms:
5-Difluoromethyl-3-bromopyridine
3-Bromo-5-(difluoromethyl)pyridine
3-Bromo-5-difluoromethylpyridine
Pyridine, 3-bromo-5-(difluoromethyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Pyridine, 3-bromo-5-(difluoromethyl)- REF: IN-DA000EGHCAS: 114468-04-1	95%	To inquire	Tue 04 Mar 25
3-Bromo-5-(difluoromethyl)pyridine REF: 54-PC520723CAS: 114468-04-1	95%	140.00 €~683.00 €	Mon 03 Mar 25
3-Bromo-5-(difluoromethyl)pyridine REF: 10-F050446CAS: 114468-04-1	95.0%	109.00 €~556.00 €	Wed 05 Mar 25
3-Bromo-5-(difluoromethyl)pyridine REF: 3D-PEA46804CAS: 114468-04-1	Min. 95%	To inquire	Tue 15 Apr 25