CAS 114474-27-0
:4-(4-Nitrophenyl)-1-phenyl-1H-pyrazole
Description:
4-(4-Nitrophenyl)-1-phenyl-1H-pyrazole, with the CAS number 114474-27-0, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a nitrophenyl substituent, contributing to its aromatic properties and potential reactivity. The presence of the nitro group (-NO2) on the para position of the phenyl ring enhances its electron-withdrawing characteristics, which can influence the compound's chemical behavior, including its reactivity in electrophilic aromatic substitution reactions. The pyrazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and material science. It may exhibit properties such as fluorescence or photostability, depending on its molecular structure and environment. Additionally, the compound's solubility, melting point, and stability can vary based on the solvent and conditions used. Overall, 4-(4-Nitrophenyl)-1-phenyl-1H-pyrazole is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H11N3O2
InChI:InChI=1S/C15H11N3O2/c19-18(20)15-8-6-12(7-9-15)13-10-16-17(11-13)14-4-2-1-3-5-14/h1-11H
InChI key:InChIKey=UPVDNBDVXNPWKC-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(C2=CN(N=C2)C3=CC=CC=C3)C=C1
Synonyms:- 4-(4-Nitrophenyl)-1-phenyl-1H-pyrazole
- 1H-Pyrazole, 4-(4-nitrophenyl)-1-phenyl-
- 1-Phenyl-4-(4-nitrophenyl)pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
