CymitQuimica logo

CAS 114479-35-5

:

9H-Thieno[2,3-b]carbazole

Description:
9H-Thieno[2,3-b]carbazole is a heterocyclic compound characterized by its fused thieno and carbazole structures. This compound features a sulfur atom within the thieno ring, contributing to its unique electronic properties. It is typically a solid at room temperature and exhibits a relatively high thermal stability, making it suitable for various applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). The presence of both nitrogen and sulfur atoms in its structure enhances its electron-donating capabilities, which is beneficial for charge transport in electronic devices. Additionally, 9H-Thieno[2,3-b]carbazole can exhibit interesting photophysical properties, including fluorescence, which can be tuned by modifying its substituents. Its solubility in organic solvents allows for ease of processing in thin-film applications. Overall, this compound is of significant interest in materials science and organic chemistry due to its potential in advanced electronic applications.
Formula:C14H9NS
InChI:InChI=1S/C14H9NS/c1-2-4-12-10(3-1)11-7-9-5-6-16-14(9)8-13(11)15-12/h1-8,15H
InChI key:InChIKey=JWPSJJSPEZKFHQ-UHFFFAOYSA-N
SMILES:C1=2C=3C(NC1=CC4=C(C2)C=CS4)=CC=CC3
Synonyms:
  • 9H-Thieno[2,3-b]carbazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.