CAS 114482-61-0

4-(3-Buten-1-yloxy)phenyl 4-methoxybenzoate

Description:

4-(3-Buten-1-yloxy)phenyl 4-methoxybenzoate, with the CAS number 114482-61-0, is an organic compound characterized by its ester functional group, which is formed from the reaction of a phenolic compound and a carboxylic acid derivative. This compound features a butenyl ether side chain, contributing to its reactivity and potential applications in organic synthesis. The presence of both methoxy and butenyl groups enhances its chemical properties, making it suitable for various applications, including as a potential intermediate in the synthesis of more complex molecules or in materials science. Its structure suggests that it may exhibit interesting photochemical properties, which could be leveraged in fields such as photopolymerization or as a UV filter. Additionally, the compound's solubility and stability in different solvents can vary, influencing its practical applications. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.

Formula: C₁₈H₁₈O₄

InChI: InChI=1S/C18H18O4/c1-3-4-13-21-16-9-11-17(12-10-16)22-18(19)14-5-7-15(20-2)8-6-14/h3,5-12H,1,4,13H2,2H3

InChI key: InChIKey=NYLQIBUIWUSWGU-UHFFFAOYSA-N

SMILES: O(C(=O)C1=CC=C(OC)C=C1)C2=CC=C(OCCC=C)C=C2

Synonyms:

• 4-(3-butenyloxy)phenyl 4-methoxybenzoate
• Benzoic acid, 4-methoxy-, 4-(3-butenyloxy)phenyl ester
• Benzoic acid, 4-methoxy-, 4-(3-buten-1-yloxy)phenyl ester
• 4-(3-Buten-1-yloxy)phenyl 4-methoxybenzoate

Benzoic acid, 4-methoxy-, 4-(3-buten-1-yloxy)phenyl ester

CAS: 114482-61-0

Formula: C₁₈H₁₈O₄

Molecular weight: 298.3331

Ref: IN-DA000EIX