CAS 114482-86-9

Baicalein 7-O-diglucoside

Description:

Baicalein 7-O-diglucoside is a flavonoid glycoside derived from baicalein, a compound found in various plants, particularly in the roots of Scutellaria baicalensis. This substance is characterized by its two glucose moieties attached to the hydroxyl group at the 7-position of the baicalein structure. It exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is typically soluble in water due to its glycosylated nature, which enhances its bioavailability compared to its aglycone counterpart. Baicalein 7-O-diglucoside is often studied for its effects on various cellular pathways and its potential therapeutic applications in traditional medicine. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a significant area of interest in natural product chemistry and medicinal research.

Formula: C₂₇H₃₀O₁₅

InChI: InChI=1S/C27H30O15/c28-8-15-19(31)22(34)24(36)26(41-15)38-9-16-20(32)23(35)25(37)27(42-16)40-14-7-13-17(21(33)18(14)30)11(29)6-12(39-13)10-4-2-1-3-5-10/h1-7,15-16,19-20,22-28,30-37H,8-9H2/t15-,16-,19-,20-,22+,23+,24-,25-,26-,27-/m1/s1

InChI key: InChIKey=HAYLVXFWJCKKDW-IJTBWITGSA-N

SMILES: OC1=C2C(OC(=CC2=O)C3=CC=CC=C3)=CC(O[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)=C1O

Synonyms:

• 4H-1-Benzopyran-4-one, 7-[(6-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5,6-dihydroxy-2-phenyl-
• 4H-1-Benzopyran-4-one,7-[(6-O-b-D-glucopyranosyl-b-D-glucopyranosyl)oxy]-5,6-dihydroxy-2-phenyl-
• 7-[(6-O-β-<span class="text-smallcaps">D</smallcap>-Glucopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5,6-dihydroxy-2-phenyl-4H-1-benzopyran-4-one
• Baicalein 7-O-β-gentiobioside
• Baicalein-7-O-diglucoside
• Baicalein7-O-b-gentiobioside
• 7-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5,6-dihydroxy-2-phenyl-4H-1-benzopyran-4-one
• Oroxin B

Baicalin-7-diglucoside

CAS: 114482-86-9

Formula: C₂₇H₃₀O₁₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 594.5181

Ref: IN-DA008UYJ

Oroxin B

CAS: 114482-86-9

Oroxin B

Purity: ≥98%

Molecular weight: 594.52g/mol

Ref: 54-BUP00030

Oroxin B

CAS: 114482-86-9

Oroxin B

Purity: 98%

Molecular weight: 594.52g/mol

Ref: 54-OR1024423

Oroxin B

CAS: 114482-86-9

Formula: C₂₇H₃₀O₁₅

Molecular weight: 594.52

Ref: 7W-GY6624

Oroxin B

CAS: 114482-86-9

Oroxin B can selectively induce tumor-suppressive ER stress and concurrently inhibit tumor-adaptive ER stress in B-lymphoma cells for effective anti-lymphoma therapy.

Formula: C₂₇H₃₀O₁₅

Purity: 95%~99%

Molecular weight: 594.522

Ref: BP-BP1044

Oroxin B

CAS: 114482-86-9

Oroxin B (Hypocretin-2) has antioxidant activity.

Formula: C₂₇H₃₀O₁₅

Purity: 98.22% - 99.81%

Color and Shape: Solid

Molecular weight: 594.52

Ref: TM-T3780

Baicalein 7-diglucoside

CAS: 114482-86-9

Natural glycoside

Formula: C₂₇H₃₀O₁₅

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 594.53

Ref: 5G-83479