CAS 114483-64-6
:2-[(4-Chlorophenyl)methoxy]-5-nitrobenzaldehyde
Description:
2-[(4-Chlorophenyl)methoxy]-5-nitrobenzaldehyde, with the CAS number 114483-64-6, is an organic compound characterized by its complex aromatic structure. It features a nitro group (-NO2) and an aldehyde group (-CHO) attached to a benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methoxy group (-OCH3) and a chlorophenyl moiety enhances its chemical properties, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the electron-withdrawing effects of the nitro and chloro substituents, which can influence electrophilic aromatic substitution reactions. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as compounds with nitro and aldehyde functionalities can pose health risks.
Formula:C14H10ClNO4
InChI:InChI=1S/C14H10ClNO4/c15-12-3-1-10(2-4-12)9-20-14-6-5-13(16(18)19)7-11(14)8-17/h1-8H,9H2
InChI key:InChIKey=WAFZNGHFRACZCN-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(Cl)C=C1)C2=C(C=O)C=C(N(=O)=O)C=C2
Synonyms:- 2-[(4-Chlorobenzyl)oxy]-5-nitrobenzaldehyde
- Benzaldehyde, 2-[(4-chlorophenyl)methoxy]-5-nitro-
- 2-[(4-Chlorophenyl)methoxy]-5-nitrobenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
