CAS 114492-65-8

Bis(2-chloropropyl) 2,3-dibromopropyl phosphate

Description:

Bis(2-chloropropyl) 2,3-dibromopropyl phosphate, identified by its CAS number 114492-65-8, is an organophosphate compound characterized by its complex molecular structure, which includes multiple halogen substituents. This substance typically appears as a colorless to pale yellow liquid and is known for its use as a flame retardant and plasticizer in various applications. Its chemical properties include a relatively high density and low volatility, which contribute to its stability in formulations. The presence of chlorine and bromine atoms enhances its flame-retardant capabilities, making it effective in reducing flammability in materials. However, due to its organophosphate nature, it may pose environmental and health concerns, particularly regarding toxicity and potential bioaccumulation. Safety measures are essential when handling this compound, as it may exhibit harmful effects upon exposure. Overall, Bis(2-chloropropyl) 2,3-dibromopropyl phosphate is significant in industrial applications, but its environmental impact necessitates careful management.

Formula: C₉H₁₇Br₂Cl₂O₄P

InChI: InChI=1S/C9H17Br2Cl2O4P/c1-7(12)4-15-18(14,16-5-8(2)13)17-6-9(11)3-10/h7-9H,3-6H2,1-2H3

InChI key: InChIKey=OAWAXRZMMCPJOJ-UHFFFAOYSA-N

SMILES: P(OCC(CBr)Br)(OCC(C)Cl)(OCC(C)Cl)=O

Synonyms:

• Phosphoric acid, bis(2-chloropropyl) 2,3-dibromopropyl ester
• Bis(2-chloropropyl) 2,3-dibromopropyl phosphate

Phosphoric acid, bis(2-chloropropyl) 2,3-dibromopropyl ester

CAS: 114492-65-8

Formula: C₉H₁₇Br₂Cl₂O₄P

Molecular weight: 450.9166

Ref: IN-DA000EJA