CAS 114498-56-5

2-(1,1-Dimethylethyl)thiazolo[5,4-c]pyridine

Description:

2-(1,1-Dimethylethyl)thiazolo[5,4-c]pyridine, identified by its CAS number 114498-56-5, is a heterocyclic organic compound featuring a thiazole and pyridine ring system. This compound is characterized by the presence of a bulky tert-butyl group (1,1-dimethylethyl) attached to the thiazole moiety, which influences its physical and chemical properties, such as solubility and reactivity. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound may exhibit moderate to high lipophilicity due to the presence of the tert-butyl group, which can affect its absorption and distribution in biological systems. Additionally, the nitrogen atoms in the pyridine and thiazole rings can participate in hydrogen bonding and coordination with metal ions, making this compound of interest in coordination chemistry and medicinal chemistry. Overall, 2-(1,1-Dimethylethyl)thiazolo[5,4-c]pyridine is a versatile compound with potential applications in various fields, including drug development and materials science.

Formula: C₁₀H₁₂N₂S

InChI: InChI=1S/C10H12N2S/c1-10(2,3)9-12-7-4-5-11-6-8(7)13-9/h4-6H,1-3H3

InChI key: InChIKey=JVQXNSAZDKERHG-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=NC=2C(S1)=CN=CC2

Synonyms:

• 2-(1,1-Dimethylethyl)thiazolo[5,4-c]pyridine
• Thiazolo[5,4-c]pyridine, 2-(1,1-dimethylethyl)-
• 2-tert-Butylthiazolo[5,4-c]pyridine

Thiazolo[5,4-c]pyridine, 2-(1,1-dimethylethyl)-

CAS: 114498-56-5

Formula: C₁₀H₁₂N₂S

Molecular weight: 192.2807

Ref: IN-DA000EK2