
CAS 114498-65-6
:(3E)-4-(4-Ethylphenyl)-3-buten-2-one
Description:
(3E)-4-(4-Ethylphenyl)-3-buten-2-one, with the CAS number 114498-65-6, is an organic compound characterized by its conjugated double bond system and a ketone functional group. This compound features a butenone backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-ethylphenyl substituent enhances its hydrophobic character and may influence its solubility in various organic solvents. Typically, compounds of this nature exhibit properties such as moderate volatility and the ability to participate in electrophilic addition reactions due to the electron-withdrawing nature of the ketone group. Additionally, the geometric configuration (3E) indicates that the double bond is in the trans configuration, which can affect the compound's physical properties, including melting and boiling points. Such compounds are often studied for their potential biological activities and applications in materials science, particularly in the development of dyes, fragrances, or as intermediates in the synthesis of more complex molecules.
Formula:C12H14O
InChI:InChI=1S/C12H14O/c1-3-11-6-8-12(9-7-11)5-4-10(2)13/h4-9H,3H2,1-2H3/b5-4+
InChI key:InChIKey=HROYTUBGASOINW-SNAWJCMRSA-N
SMILES:C(=C/C(C)=O)\C1=CC=C(CC)C=C1
Synonyms:- 3-Buten-2-one, 4-(4-ethylphenyl)-, (E)-
- (3E)-4-(4-Ethylphenyl)-3-buten-2-one
- 3-Buten-2-one, 4-(4-ethylphenyl)-, (3E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.