CAS 1145-60-4
:4-BENZYLBENZENESULFONAMIDE
Description:
4-Benzyldiphenylsulfonamide, with the CAS number 1145-60-4, is an organic compound characterized by its sulfonamide functional group attached to a benzyl group and two phenyl rings. This compound typically appears as a white to off-white crystalline solid. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. The presence of the sulfonamide group imparts certain biological activities, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure allows for potential interactions with biological targets, which can lead to various therapeutic applications. Additionally, 4-benzylbenzenesulfonamide may exhibit properties such as thermal stability and the ability to form hydrogen bonds, influencing its reactivity and interactions in chemical processes. Safety data indicates that, like many sulfonamides, it should be handled with care due to potential irritant effects. Overall, this compound serves as a valuable building block in organic synthesis and medicinal chemistry.
Formula:C13H13NO2S
InChI:InChI=1/C13H13NO2S/c14-17(15,16)13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,14,15,16)
SMILES:c1ccc(cc1)Cc1ccc(cc1)S(=O)(=O)N
Synonyms:- Benzenesulfonamide, 4-(Phenylmethyl)-
- 4-Benzylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
