CAS 1145-73-9: 4-Dimethylaminostilbene
Description:4-Dimethylaminostilbene is an organic compound characterized by its structure, which consists of a stilbene backbone with two dimethylamino groups attached to the para positions of the phenyl rings. This compound is typically a solid at room temperature and exhibits a crystalline form. It is known for its strong fluorescence properties, making it useful in various applications, including as a fluorescent dye and in photophysical studies. The presence of the dimethylamino groups contributes to its electron-donating characteristics, which can influence its reactivity and interaction with other chemical species. Additionally, 4-Dimethylaminostilbene can undergo various chemical reactions, including oxidation and electrophilic substitution, due to the presence of the aromatic rings. Its solubility varies depending on the solvent, often being more soluble in polar organic solvents. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4-Dimethylaminostilbene is a significant compound in organic chemistry and materials science due to its unique properties.
Formula:C16H17N
InChI:InChI=1S/C16H17N/c1-17(2)16-12-10-15(11-13-16)9-8-14-6-4-3-5-7-14/h3-13H,1-2H3
InChI key:InChIKey=XGHHHPDRXLIMPM-UHFFFAOYSA-N
SMILES:C=1C=CC(=CC1)C=CC2=CC=C(C=C2)N(C)C
- Synonyms:
- 4-(Dimethylamino)stilbene
- 4-(N,N-Dimethylamino)stilbene
- 4-Dimethylaminostilbene
- 4-Stilbenamine, N,N-dimethyl-
- Benzenamine, N,N-dimethyl-4-(2-phenylethenyl)-
- N,N-Dimethyl-4-(2-phenylethenyl)benzenamine
- N,N-dimethyl-4-(2-phenylethenyl)aniline
- N,N-dimethyl-4-[(E)-2-phenylethenyl]aniline
- NSC 30991

4-(Dimethylamino)stilbene
Ref: 3B-D0255
1g | 39.00 € | ||
5g | 112.00 € |

Benzenamine, N,N-dimethyl-4-(2-phenylethenyl)-
Ref: IN-DA000EKW
1g | 88.00 € | ||
5g | 197.00 € | ||
250mg | 52.00 € |

Ref: 54-OR1025174
1g | 86.00 € | ||
5g | 345.00 € | ||
25g | 1,488.00 € | ||
250mg | 32.00 € |

4-Dimethylaminostilbene
Ref: 3D-FD65988
2g | 147.00 € | ||
5g | 251.00 € | ||
10g | 424.00 € |