CymitQuimica logo

CAS 114501-03-0

:

Methyl 2-[(2-methylphenyl)amino]-3-pyridinecarboxylate

Description:
Methyl 2-[(2-methylphenyl)amino]-3-pyridinecarboxylate, identified by its CAS number 114501-03-0, is an organic compound characterized by its complex structure, which includes a pyridine ring and an amine group. This substance typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The methyl ester functional group contributes to its chemical reactivity, making it a candidate for various chemical transformations. Additionally, the presence of the 2-methylphenyl moiety may influence its biological activity and interactions, suggesting potential applications in pharmaceuticals or agrochemicals. The compound's molecular structure allows for various intermolecular interactions, which can affect its physical properties, such as boiling and melting points. Overall, Methyl 2-[(2-methylphenyl)amino]-3-pyridinecarboxylate is a compound of interest in organic synthesis and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C14H14N2O2
InChI:InChI=1S/C14H14N2O2/c1-10-6-3-4-8-12(10)16-13-11(14(17)18-2)7-5-9-15-13/h3-9H,1-2H3,(H,15,16)
InChI key:InChIKey=OYGGIDJDUCQZIH-UHFFFAOYSA-N
SMILES:N(C1=C(C(OC)=O)C=CC=N1)C2=C(C)C=CC=C2
Synonyms:
  • Methyl 2-[(2-methylphenyl)amino]-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 2-[(2-methylphenyl)amino]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.