CAS 114506-04-6
:(2E)-4-bromo-1-chloro-2-methylbut-2-ene
Description:
(2E)-4-bromo-1-chloro-2-methylbut-2-ene is an organic compound characterized by its unsaturated hydrocarbon structure, featuring both bromine and chlorine substituents. This compound belongs to the class of alkenes, specifically a substituted butene, which indicates the presence of a double bond between carbon atoms. The "2E" notation signifies the configuration of the double bond, indicating that the higher priority substituents on either end of the double bond are on opposite sides, which can influence its reactivity and physical properties. The presence of halogens (bromine and chlorine) introduces significant polarity, affecting its solubility and reactivity in various chemical reactions, such as nucleophilic substitutions or eliminations. The compound's molecular structure contributes to its potential applications in organic synthesis and as an intermediate in the production of other chemical entities. Additionally, its specific stereochemistry and functional groups may impart unique characteristics that can be exploited in medicinal chemistry or materials science.
Formula:C5H8BrCl
InChI:InChI=1/C5H8BrCl/c1-5(4-7)2-3-6/h2H,3-4H2,1H3/b5-2+
Synonyms:- 2-Butene, 4-bromo-1-chloro-2-methyl-, (2E)-
- (E)-4-Bromo-1-chloro-2-methyl-2-butene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Butene, 4-bromo-1-chloro-2-methyl-, (2E)-
CAS:Formula:C5H8BrClColor and Shape:LiquidMolecular weight:183.474(E)-4-Bromo-1-chloro-2-methyl-2-butene
CAS:Controlled Product<p>Stability Light Sensitive, Moisture Sensitive, Temperature Sensitive<br>Applications (E)-4-Bromo-1-chloro-2-methyl-2-butene (cas# 114506-04-6) is a compound useful in organic synthesis.<br></p>Formula:C5H8BrClColor and Shape:NeatMolecular weight:183.47

